C25H36O5Si — CID 134872934
(4S,4aS,8S,8aR,8bS)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-4a-methyl-8b-phenylmethoxy-1,2a,3,4,8,8a-hexahydronaphtho[2,1-b]oxet-7-one (PubChem CID 134872934) has the molecular formula C25H36O5Si and a molecular weight of 444.64 g/mol. Its IUPAC name is (4S,4aS,8S,8aR,8bS)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-4a-methyl-8b-phenylmethoxy-1,2a,3,4,8,8a-hexahydronaphtho[2,1-b]oxet-7-one.
| Compound Name | (4S,4aS,8S,8aR,8bS)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-4a-methyl-8b-phenylmethoxy-1,2a,3,4,8,8a-hexahydronaphtho[2,1-b]oxet-7-one |
|---|---|
| PubChem CID | 134872934 |
| Molecular Formula | C25H36O5Si |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | (4S,4aS,8S,8aR,8bS)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-4a-methyl-8b-phenylmethoxy-1,2a,3,4,8,8a-hexahydronaphtho[2,1-b]oxet-7-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC2OC[C@@]2(OCc2ccccc2)[C@H]2[C@H](O)C(=O)C=C[C@]12C |
| InChI | InChI=1S/C25H36O5Si/c1-23(2,3)31(5,6)30-19-14-20-25(16-28-20,29-15-17-10-8-7-9-11-17)22-21(27)18(26)12-13-24(19,22)4/h7-13,19-22,27H,14-16H2,1-6H3/t19-,20?,21+,22-,24+,25-/m0/s1 |
| InChIKey | NJIKVAWPKSZBTE-XTVPONHOSA-N |
| XLogP | 4.26 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|