C18H30O3Si — CID 134872954
methyl (1S,5R,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-(2-methylprop-1-enyl)bicyclo[3.1.0]hex-2-ene-1-carboxylate (PubChem CID 134872954) has the molecular formula C18H30O3Si and a molecular weight of 322.52 g/mol. Its IUPAC name is methyl (1S,5R,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-(2-methylprop-1-enyl)bicyclo[3.1.0]hex-2-ene-1-carboxylate.
| Compound Name | methyl (1S,5R,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-(2-methylprop-1-enyl)bicyclo[3.1.0]hex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 134872954 |
| Molecular Formula | C18H30O3Si |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | methyl (1S,5R,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-(2-methylprop-1-enyl)bicyclo[3.1.0]hex-2-ene-1-carboxylate |
| SMILES | COC(=O)[C@@]12C(O[Si](C)(C)C(C)(C)C)=CC[C@@H]1[C@H]2C=C(C)C |
| InChI | InChI=1S/C18H30O3Si/c1-12(2)11-14-13-9-10-15(18(13,14)16(19)20-6)21-22(7,8)17(3,4)5/h10-11,13-14H,9H2,1-8H3/t13-,14-,18+/m1/s1 |
| InChIKey | UNSDQBODMYKBNI-LBTNJELSSA-N |
| XLogP | 4.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|