C25H19F5N2O5 — CID 134873010
(2,3,4,5,6-pentafluorophenyl) (2S)-3-phenyl-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoate (PubChem CID 134873010) has the molecular formula C25H19F5N2O5 and a molecular weight of 522.43 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (2S)-3-phenyl-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (2S)-3-phenyl-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 134873010 |
| Molecular Formula | C25H19F5N2O5 |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (2S)-3-phenyl-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoate |
| SMILES | O=C(CNC(=O)OCc1ccccc1)N[C@@H](Cc1ccccc1)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C25H19F5N2O5/c26-18-19(27)21(29)23(22(30)20(18)28)37-24(34)16(11-14-7-3-1-4-8-14)32-17(33)12-31-25(35)36-13-15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H,31,35)(H,32,33)/t16-/m0/s1 |
| InChIKey | CJWQYYGRLYHIFK-INIZCTEOSA-N |
| XLogP | 3.94 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|