C23H36F2O4Si — CID 134873161
dimethyl 2-[4,4-difluoro-2-tri(propan-2-yl)silylbuta-2,3-dienyl]-2-pent-2-ynylpropanedioate (PubChem CID 134873161) has the molecular formula C23H36F2O4Si and a molecular weight of 442.62 g/mol. Its IUPAC name is dimethyl 2-[4,4-difluoro-2-tri(propan-2-yl)silylbuta-2,3-dienyl]-2-pent-2-ynylpropanedioate.
| Compound Name | dimethyl 2-[4,4-difluoro-2-tri(propan-2-yl)silylbuta-2,3-dienyl]-2-pent-2-ynylpropanedioate |
|---|---|
| PubChem CID | 134873161 |
| Molecular Formula | C23H36F2O4Si |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | dimethyl 2-[4,4-difluoro-2-tri(propan-2-yl)silylbuta-2,3-dienyl]-2-pent-2-ynylpropanedioate |
| SMILES | CCC#CCC(CC(=C=C(F)F)[Si](C(C)C)(C(C)C)C(C)C)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C23H36F2O4Si/c1-10-11-12-13-23(21(26)28-8,22(27)29-9)15-19(14-20(24)25)30(16(2)3,17(4)5)18(6)7/h16-18H,10,13,15H2,1-9H3 |
| InChIKey | WRMBXIGZQIPKHO-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|