C28H29NO2 — CID 134873197
(3Z,5Z)-6-methoxy-2,5,6-triphenyl-N-propan-2-ylhexa-3,5-dienamide (PubChem CID 134873197) has the molecular formula C28H29NO2 and a molecular weight of 411.55 g/mol. Its IUPAC name is (3Z,5Z)-6-methoxy-2,5,6-triphenyl-N-propan-2-ylhexa-3,5-dienamide.
| Compound Name | (3Z,5Z)-6-methoxy-2,5,6-triphenyl-N-propan-2-ylhexa-3,5-dienamide |
|---|---|
| PubChem CID | 134873197 |
| Molecular Formula | C28H29NO2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | (3Z,5Z)-6-methoxy-2,5,6-triphenyl-N-propan-2-ylhexa-3,5-dienamide |
| SMILES | CO/C(=C(/C=C\C(C(=O)NC(C)C)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H29NO2/c1-21(2)29-28(30)26(23-15-9-5-10-16-23)20-19-25(22-13-7-4-8-14-22)27(31-3)24-17-11-6-12-18-24/h4-21,26H,1-3H3,(H,29,30)/b20-19-,27-25- |
| InChIKey | XDMFNIPTNDLEPV-KSZRARIFSA-N |
| XLogP | 6.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|