C26H22N2O5 — CID 134873516
[2-cyano-3-[(E)-ethoxymethylideneamino]-1-(4-methoxyphenyl)-1H-benzo[f]chromen-9-yl] acetate (PubChem CID 134873516) has the molecular formula C26H22N2O5 and a molecular weight of 442.47 g/mol. Its IUPAC name is [2-cyano-3-[(E)-ethoxymethylideneamino]-1-(4-methoxyphenyl)-1H-benzo[f]chromen-9-yl] acetate.
| Compound Name | [2-cyano-3-[(E)-ethoxymethylideneamino]-1-(4-methoxyphenyl)-1H-benzo[f]chromen-9-yl] acetate |
|---|---|
| PubChem CID | 134873516 |
| Molecular Formula | C26H22N2O5 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | [2-cyano-3-[(E)-ethoxymethylideneamino]-1-(4-methoxyphenyl)-1H-benzo[f]chromen-9-yl] acetate |
| SMILES | CCO/C=N/C1=C(C#N)C(c2ccc(OC)cc2)c2c(ccc3ccc(OC(C)=O)cc23)O1 |
| InChI | InChI=1S/C26H22N2O5/c1-4-31-15-28-26-22(14-27)24(18-6-9-19(30-3)10-7-18)25-21-13-20(32-16(2)29)11-5-17(21)8-12-23(25)33-26/h5-13,15,24H,4H2,1-3H3/b28-15+ |
| InChIKey | LPQDWSZWZXEMPY-RWPZCVJISA-N |
| XLogP | 5.10 |
| TPSA | 90.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|