C13H26ClN3O4 — CID 134873525
(E)-1-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)-N,N,3,3-tetramethylbut-1-en-2-amine perchlorate (PubChem CID 134873525) has the molecular formula C13H26ClN3O4 and a molecular weight of 323.82 g/mol. Its IUPAC name is (E)-1-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)-N,N,3,3-tetramethylbut-1-en-2-amine perchlorate.
| Compound Name | (E)-1-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)-N,N,3,3-tetramethylbut-1-en-2-amine perchlorate |
|---|---|
| PubChem CID | 134873525 |
| Molecular Formula | C13H26ClN3O4 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (E)-1-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)-N,N,3,3-tetramethylbut-1-en-2-amine perchlorate |
| SMILES | CN1CC[N+](C)=C1/C=C(/N(C)C)C(C)(C)C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C13H26N3.ClHO4/c1-13(2,3)11(14(4)5)10-12-15(6)8-9-16(12)7;2-1(3,4)5/h10H,8-9H2,1-7H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | OOSBXSSQTGCFDQ-UHFFFAOYSA-M |
| XLogP | -3.29 |
| TPSA | 101.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|