C7H7F3O3 — CID 134873560
(E)-1,1,1-trifluoro-6-methoxyhex-5-ene-2,4-dione (PubChem CID 134873560) has the molecular formula C7H7F3O3 and a molecular weight of 196.12 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-6-methoxyhex-5-ene-2,4-dione.
| Compound Name | (E)-1,1,1-trifluoro-6-methoxyhex-5-ene-2,4-dione |
|---|---|
| PubChem CID | 134873560 |
| Molecular Formula | C7H7F3O3 |
| Molecular Weight | 196.12 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | (E)-1,1,1-trifluoro-6-methoxyhex-5-ene-2,4-dione |
| SMILES | CO/C=C/C(=O)CC(=O)C(F)(F)F |
| InChI | InChI=1S/C7H7F3O3/c1-13-3-2-5(11)4-6(12)7(8,9)10/h2-3H,4H2,1H3/b3-2+ |
| InChIKey | QALWFEVSCZWFSP-NSCUHMNNSA-N |
| XLogP | 1.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.12 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|