C36H36N2O5 — CID 134873688
(Z)-1-[4-[(R)-benzoyloxy-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinolin-1-ium-1-yl]-3-phenoxyprop-1-en-1-olate (PubChem CID 134873688) has the molecular formula C36H36N2O5 and a molecular weight of 576.69 g/mol. Its IUPAC name is (Z)-1-[4-[(R)-benzoyloxy-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinolin-1-ium-1-yl]-3-phenoxyprop-1-en-1-olate.
| Compound Name | (Z)-1-[4-[(R)-benzoyloxy-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinolin-1-ium-1-yl]-3-phenoxyprop-1-en-1-olate |
|---|---|
| PubChem CID | 134873688 |
| Molecular Formula | C36H36N2O5 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | (Z)-1-[4-[(R)-benzoyloxy-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinolin-1-ium-1-yl]-3-phenoxyprop-1-en-1-olate |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@H](OC(=O)c1ccccc1)c1cc[n+](/C([O-])=C/COc2ccccc2)c2ccc(OC)cc12 |
| InChI | InChI=1S/C36H36N2O5/c1-3-25-24-37-19-16-27(25)22-33(37)35(43-36(40)26-10-6-4-7-11-26)30-17-20-38(32-15-14-29(41-2)23-31(30)32)34(39)18-21-42-28-12-8-5-9-13-28/h3-15,17-18,20,23,25,27,33,35H,1,16,19,21-22,24H2,2H3/b34-18-/t25-,27-,33-,35+/m0/s1 |
| InChIKey | VUILZGUHUYPAJF-DAPVRJMZSA-N |
| XLogP | 5.17 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|