About 1-[(E)-1,2-difluoroethenoxy]-1,2,2-trifluoroethane
1-[(E)-1,2-difluoroethenoxy]-1,2,2-trifluoroethane (PubChem CID 134873738) has the molecular formula C4H3F5O
and a molecular weight of 162.06 g/mol. Its IUPAC name is 1-[(E)-1,2-difluoroethenoxy]-1,2,2-trifluoroethane.
Molecular Properties
| Compound Name | 1-[(E)-1,2-difluoroethenoxy]-1,2,2-trifluoroethane |
| PubChem CID | 134873738 |
| Molecular Formula | C4H3F5O |
| Molecular Weight | 162.06 g/mol |
| Exact Mass | 162.01 |
| IUPAC Name | 1-[(E)-1,2-difluoroethenoxy]-1,2,2-trifluoroethane |
| SMILES | F/C=C(/F)OC(F)C(F)F |
| InChI | InChI=1S/C4H3F5O/c5-1-2(6)10-4(9)3(7)8/h1,3-4H/b2-1- |
| InChIKey | LIAVQCQXTWRKEZ-UPHRSURJSA-N |
| XLogP | 2.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.06 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-1,2-difluoroethenoxy]-1,2,2-trifluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-1,2-difluoroethenoxy]-1,2,2-trifluoroethane?
The IUPAC name of 1-[(E)-1,2-difluoroethenoxy]-1,2,2-trifluoroethane (CID 134873738) is 1-[(E)-1,2-difluoroethenoxy]-1,2,2-trifluoroethane.
What is the SMILES notation for 1-[(E)-1,2-difluoroethenoxy]-1,2,2-trifluoroethane?
The canonical SMILES for 1-[(E)-1,2-difluoroethenoxy]-1,2,2-trifluoroethane is F/C=C(/F)OC(F)C(F)F.
What is the InChIKey of 1-[(E)-1,2-difluoroethenoxy]-1,2,2-trifluoroethane?
The InChIKey is LIAVQCQXTWRKEZ-UPHRSURJSA-N. The full InChI is InChI=1S/C4H3F5O/c5-1-2(6)10-4(9)3(7)8/h1,3-4H/b2-1-.
What are the key properties of 1-[(E)-1,2-difluoroethenoxy]-1,2,2-trifluoroethane?
1-[(E)-1,2-difluoroethenoxy]-1,2,2-trifluoroethane has a molecular weight of 162.06 g/mol, XLogP of 2.30, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-1,2-difluoroethenoxy]-1,2,2-trifluoroethane is sourced from PubChem (CID 134873738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).