About CID 134873841
CID 134873841 (PubChem CID 134873841) has the molecular formula C21H31NO2Si+
and a molecular weight of 357.57 g/mol.
Molecular Properties
| Compound Name | CID 134873841 |
| PubChem CID | 134873841 |
| Molecular Formula | C21H31NO2Si+ |
| Molecular Weight | 357.57 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | — |
| SMILES | CC/C(=C(/O)[N+]1[CH][CH][CH][C]1CO[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H31NO2Si/c1-7-19(17-12-9-8-10-13-17)20(23)22-15-11-14-18(22)16-24-25(5,6)21(2,3)4/h8-15,23H,7,16H2,1-6H3/q+1/b20-19- |
| InChIKey | VRRSPRGJFYEMTL-VXPUYCOJSA-N |
| XLogP | 5.60 |
| TPSA | 35.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.57 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 134873841 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134873841?
The IUPAC name of CID 134873841 (CID 134873841) is not available.
What is the SMILES notation for CID 134873841?
The canonical SMILES for CID 134873841 is CC/C(=C(/O)[N+]1[CH][CH][CH][C]1CO[Si](C)(C)C(C)(C)C)c1ccccc1.
What is the InChIKey of CID 134873841?
The InChIKey is VRRSPRGJFYEMTL-VXPUYCOJSA-N. The full InChI is InChI=1S/C21H31NO2Si/c1-7-19(17-12-9-8-10-13-17)20(23)22-15-11-14-18(22)16-24-25(5,6)21(2,3)4/h8-15,23H,7,16H2,1-6H3/q+1/b20-19-.
What are the key properties of CID 134873841?
CID 134873841 has a molecular weight of 357.57 g/mol, XLogP of 5.60, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134873841 is sourced from PubChem (CID 134873841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).