C11H13N3O4S — CID 134873937
2,2-dimethyl-5-[methylsulfanyl-(1H-pyrazol-5-ylamino)methylidene]-1,3-dioxane-4,6-dione (PubChem CID 134873937) has the molecular formula C11H13N3O4S and a molecular weight of 283.31 g/mol. Its IUPAC name is 2,2-dimethyl-5-[methylsulfanyl-(1H-pyrazol-5-ylamino)methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[methylsulfanyl-(1H-pyrazol-5-ylamino)methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 134873937 |
| Molecular Formula | C11H13N3O4S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 2,2-dimethyl-5-[methylsulfanyl-(1H-pyrazol-5-ylamino)methylidene]-1,3-dioxane-4,6-dione |
| SMILES | CSC(Nc1ccn[nH]1)=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C11H13N3O4S/c1-11(2)17-9(15)7(10(16)18-11)8(19-3)13-6-4-5-12-14-6/h4-5H,1-3H3,(H2,12,13,14) |
| InChIKey | PDPPMQDJKJPCLN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|