C35H34N2O4 — CID 134874054
(Z)-1-[(2S,4S,5R)-2-[(R)-benzoyloxy-(6-methoxyquinolin-4-yl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-1-yl]-2-phenylethenolate (PubChem CID 134874054) has the molecular formula C35H34N2O4 and a molecular weight of 546.67 g/mol. Its IUPAC name is (Z)-1-[(2S,4S,5R)-2-[(R)-benzoyloxy-(6-methoxyquinolin-4-yl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-1-yl]-2-phenylethenolate.
| Compound Name | (Z)-1-[(2S,4S,5R)-2-[(R)-benzoyloxy-(6-methoxyquinolin-4-yl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-1-yl]-2-phenylethenolate |
|---|---|
| PubChem CID | 134874054 |
| Molecular Formula | C35H34N2O4 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | (Z)-1-[(2S,4S,5R)-2-[(R)-benzoyloxy-(6-methoxyquinolin-4-yl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-1-yl]-2-phenylethenolate |
| SMILES | C=C[C@H]1C[N+]2(/C([O-])=C/c3ccccc3)CC[C@H]1C[C@H]2[C@H](OC(=O)c1ccccc1)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C35H34N2O4/c1-3-25-23-37(33(38)20-24-10-6-4-7-11-24)19-17-27(25)21-32(37)34(41-35(39)26-12-8-5-9-13-26)29-16-18-36-31-15-14-28(40-2)22-30(29)31/h3-16,18,20,22,25,27,32,34H,1,17,19,21,23H2,2H3/b33-20-/t25-,27-,32-,34+,37?/m0/s1 |
| InChIKey | RTULFNPGTZCKFN-DFNZNANLSA-N |
| XLogP | 5.91 |
| TPSA | 71.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|