C11H16O — CID 134874429
[(1S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene]methanone (PubChem CID 134874429) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is [(1S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene]methanone.
| Compound Name | [(1S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene]methanone |
|---|---|
| PubChem CID | 134874429 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | [(1S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene]methanone |
| SMILES | CC1(C)C(=C=O)[C@@]2(C)CC[C@@H]1C2 |
| InChI | InChI=1S/C11H16O/c1-10(2)8-4-5-11(3,6-8)9(10)7-12/h8H,4-6H2,1-3H3/t8-,11+/m1/s1 |
| InChIKey | NVIRSHDYMLVEFR-KCJUWKMLSA-N |
| XLogP | 2.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|