About diethyl 2-[3,5-dioxo-4-(oxomethylidene)oxolan-2-ylidene]propanedioate
diethyl 2-[3,5-dioxo-4-(oxomethylidene)oxolan-2-ylidene]propanedioate (PubChem CID 134874660) has the molecular formula C12H10O8
and a molecular weight of 282.20 g/mol. Its IUPAC name is diethyl 2-[3,5-dioxo-4-(oxomethylidene)oxolan-2-ylidene]propanedioate.
Molecular Properties
| Compound Name | diethyl 2-[3,5-dioxo-4-(oxomethylidene)oxolan-2-ylidene]propanedioate |
| PubChem CID | 134874660 |
| Molecular Formula | C12H10O8 |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | diethyl 2-[3,5-dioxo-4-(oxomethylidene)oxolan-2-ylidene]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)=C1OC(=O)C(=C=O)C1=O |
| InChI | InChI=1S/C12H10O8/c1-3-18-11(16)7(12(17)19-4-2)9-8(14)6(5-13)10(15)20-9/h3-4H2,1-2H3 |
| InChIKey | WEVCNGMRHYDUCC-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[3,5-dioxo-4-(oxomethylidene)oxolan-2-ylidene]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[3,5-dioxo-4-(oxomethylidene)oxolan-2-ylidene]propanedioate?
The IUPAC name of diethyl 2-[3,5-dioxo-4-(oxomethylidene)oxolan-2-ylidene]propanedioate (CID 134874660) is diethyl 2-[3,5-dioxo-4-(oxomethylidene)oxolan-2-ylidene]propanedioate.
What is the SMILES notation for diethyl 2-[3,5-dioxo-4-(oxomethylidene)oxolan-2-ylidene]propanedioate?
The canonical SMILES for diethyl 2-[3,5-dioxo-4-(oxomethylidene)oxolan-2-ylidene]propanedioate is CCOC(=O)C(C(=O)OCC)=C1OC(=O)C(=C=O)C1=O.
What is the InChIKey of diethyl 2-[3,5-dioxo-4-(oxomethylidene)oxolan-2-ylidene]propanedioate?
The InChIKey is WEVCNGMRHYDUCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O8/c1-3-18-11(16)7(12(17)19-4-2)9-8(14)6(5-13)10(15)20-9/h3-4H2,1-2H3.
What are the key properties of diethyl 2-[3,5-dioxo-4-(oxomethylidene)oxolan-2-ylidene]propanedioate?
diethyl 2-[3,5-dioxo-4-(oxomethylidene)oxolan-2-ylidene]propanedioate has a molecular weight of 282.20 g/mol, XLogP of -0.75, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[3,5-dioxo-4-(oxomethylidene)oxolan-2-ylidene]propanedioate is sourced from PubChem (CID 134874660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).