C16H26O3Si — CID 134874786
cis-methyl (1R,2S)-2-ethenyl-1-[(2E)-3-methylpenta-2,4-dienyl]-2-trimethylsilyloxycyclopropane-1-carboxylate (PubChem CID 134874786) has the molecular formula C16H26O3Si and a molecular weight of 294.47 g/mol. Its IUPAC name is cis-methyl (1R,2S)-2-ethenyl-1-[(2E)-3-methylpenta-2,4-dienyl]-2-trimethylsilyloxycyclopropane-1-carboxylate.
| Compound Name | cis-methyl (1R,2S)-2-ethenyl-1-[(2E)-3-methylpenta-2,4-dienyl]-2-trimethylsilyloxycyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 134874786 |
| Molecular Formula | C16H26O3Si |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | cis-methyl (1R,2S)-2-ethenyl-1-[(2E)-3-methylpenta-2,4-dienyl]-2-trimethylsilyloxycyclopropane-1-carboxylate |
| SMILES | C=C/C(C)=C/C[C@@]1(C(=O)OC)C[C@@]1(C=C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H26O3Si/c1-8-13(3)10-11-15(14(17)18-4)12-16(15,9-2)19-20(5,6)7/h8-10H,1-2,11-12H2,3-7H3/b13-10+/t15-,16+/m0/s1 |
| InChIKey | SGIXHHONNAOEDD-LSALWYQZSA-N |
| XLogP | 3.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|