C16H22O — CID 134874799
(1S,2R,4S,5R,6S,7R)-5-methyl-4-[(Z)-pent-2-enyl]tricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 134874799) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is (1S,2R,4S,5R,6S,7R)-5-methyl-4-[(Z)-pent-2-enyl]tricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1S,2R,4S,5R,6S,7R)-5-methyl-4-[(Z)-pent-2-enyl]tricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 134874799 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (1S,2R,4S,5R,6S,7R)-5-methyl-4-[(Z)-pent-2-enyl]tricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | CC/C=C\C[C@@H]1C(=O)[C@H]2[C@@H]([C@H]1C)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C16H22O/c1-3-4-5-6-13-10(2)14-11-7-8-12(9-11)15(14)16(13)17/h4-5,7-8,10-15H,3,6,9H2,1-2H3/b5-4-/t10-,11-,12+,13-,14-,15+/m0/s1 |
| InChIKey | INYDMGGZEXMEOM-BYVFCIGISA-N |
| XLogP | 3.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|