C19H36O3S2Si — CID 134874848
(1S,3aS,6R,6aS)-1,5,5-trimethyl-3,3-bis(methylsulfanyl)-6-(2-trimethylsilylethoxymethoxy)-3a,4,6,6a-tetrahydro-1H-pentalen-2-one (PubChem CID 134874848) has the molecular formula C19H36O3S2Si and a molecular weight of 404.71 g/mol. Its IUPAC name is (1S,3aS,6R,6aS)-1,5,5-trimethyl-3,3-bis(methylsulfanyl)-6-(2-trimethylsilylethoxymethoxy)-3a,4,6,6a-tetrahydro-1H-pentalen-2-one.
| Compound Name | (1S,3aS,6R,6aS)-1,5,5-trimethyl-3,3-bis(methylsulfanyl)-6-(2-trimethylsilylethoxymethoxy)-3a,4,6,6a-tetrahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 134874848 |
| Molecular Formula | C19H36O3S2Si |
| Molecular Weight | 404.71 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | (1S,3aS,6R,6aS)-1,5,5-trimethyl-3,3-bis(methylsulfanyl)-6-(2-trimethylsilylethoxymethoxy)-3a,4,6,6a-tetrahydro-1H-pentalen-2-one |
| SMILES | CSC1(SC)C(=O)[C@@H](C)[C@@H]2[C@@H](OCOCC[Si](C)(C)C)C(C)(C)C[C@@H]21 |
| InChI | InChI=1S/C19H36O3S2Si/c1-13-15-14(19(23-4,24-5)16(13)20)11-18(2,3)17(15)22-12-21-9-10-25(6,7)8/h13-15,17H,9-12H2,1-8H3/t13-,14-,15-,17+/m0/s1 |
| InChIKey | FWOMDYDLALDRHI-QBYUYEEZSA-N |
| XLogP | 4.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.71 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|