About CID 134874889
CID 134874889 (PubChem CID 134874889) has the molecular formula C17H21FeNO
and a molecular weight of 311.21 g/mol.
Molecular Properties
| Compound Name | CID 134874889 |
| PubChem CID | 134874889 |
| Molecular Formula | C17H21FeNO |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C1COC([C]2[CH][CH][CH][CH]2)=N1.[CH]1[CH][CH][CH][CH]1.[Fe] |
| InChI | InChI=1S/C12H16NO.C5H5.Fe/c1-12(2,3)10-8-14-11(13-10)9-6-4-5-7-9;1-2-4-5-3-1;/h4-7,10H,8H2,1-3H3;1-5H; |
| InChIKey | AAYCPESVOFLXRR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 134874889 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134874889?
The IUPAC name of CID 134874889 (CID 134874889) is not available.
What is the SMILES notation for CID 134874889?
The canonical SMILES for CID 134874889 is CC(C)(C)C1COC([C]2[CH][CH][CH][CH]2)=N1.[CH]1[CH][CH][CH][CH]1.[Fe].
What is the InChIKey of CID 134874889?
The InChIKey is AAYCPESVOFLXRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16NO.C5H5.Fe/c1-12(2,3)10-8-14-11(13-10)9-6-4-5-7-9;1-2-4-5-3-1;/h4-7,10H,8H2,1-3H3;1-5H;.
What are the key properties of CID 134874889?
CID 134874889 has a molecular weight of 311.21 g/mol, XLogP of 3.25, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134874889 is sourced from PubChem (CID 134874889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).