C14H22O4 — CID 134874904
[(1R)-1-[(1R,2R)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)cyclopropyl]but-3-enyl] acetate (PubChem CID 134874904) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is [(1R)-1-[(1R,2R)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)cyclopropyl]but-3-enyl] acetate.
| Compound Name | [(1R)-1-[(1R,2R)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)cyclopropyl]but-3-enyl] acetate |
|---|---|
| PubChem CID | 134874904 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | [(1R)-1-[(1R,2R)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)cyclopropyl]but-3-enyl] acetate |
| SMILES | C=CC[C@@H](OC(C)=O)[C@@H]1C[C@H]1C1COC(C)(C)O1 |
| InChI | InChI=1S/C14H22O4/c1-5-6-12(17-9(2)15)10-7-11(10)13-8-16-14(3,4)18-13/h5,10-13H,1,6-8H2,2-4H3/t10-,11-,12-,13?/m1/s1 |
| InChIKey | JWUPUZLBIOPZEH-PFGBXZAXSA-N |
| XLogP | 2.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|