C17H24O5S — CID 134875001
(1S,4S,5R,8S,12S)-5-methoxy-9,9,12-trimethyl-5-(methylsulfanylmethyl)-2-oxatricyclo[6.3.1.04,12]dodecane-3,6,7-trione (PubChem CID 134875001) has the molecular formula C17H24O5S and a molecular weight of 340.44 g/mol. Its IUPAC name is (1S,4S,5R,8S,12S)-5-methoxy-9,9,12-trimethyl-5-(methylsulfanylmethyl)-2-oxatricyclo[6.3.1.04,12]dodecane-3,6,7-trione.
| Compound Name | (1S,4S,5R,8S,12S)-5-methoxy-9,9,12-trimethyl-5-(methylsulfanylmethyl)-2-oxatricyclo[6.3.1.04,12]dodecane-3,6,7-trione |
|---|---|
| PubChem CID | 134875001 |
| Molecular Formula | C17H24O5S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (1S,4S,5R,8S,12S)-5-methoxy-9,9,12-trimethyl-5-(methylsulfanylmethyl)-2-oxatricyclo[6.3.1.04,12]dodecane-3,6,7-trione |
| SMILES | CO[C@@]1(CSC)C(=O)C(=O)[C@H]2C(C)(C)CC[C@@H]3OC(=O)[C@H]1[C@@]32C |
| InChI | InChI=1S/C17H24O5S/c1-15(2)7-6-9-16(3)11(15)10(18)13(19)17(21-4,8-23-5)12(16)14(20)22-9/h9,11-12H,6-8H2,1-5H3/t9-,11-,12-,16-,17+/m0/s1 |
| InChIKey | HJEXSVFOFJYOAC-HAWHSWFCSA-N |
| XLogP | 1.87 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|