C26H35N3O3 — CID 134875043
tert-butyl N-[(2S,3S,4E)-1-phenyl-3-phenylmethoxy-4-pyrrolidin-1-yliminobutan-2-yl]carbamate (PubChem CID 134875043) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S,4E)-1-phenyl-3-phenylmethoxy-4-pyrrolidin-1-yliminobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S,4E)-1-phenyl-3-phenylmethoxy-4-pyrrolidin-1-yliminobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 134875043 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | tert-butyl N-[(2S,3S,4E)-1-phenyl-3-phenylmethoxy-4-pyrrolidin-1-yliminobutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)[C@@H](/C=N/N1CCCC1)OCc1ccccc1 |
| InChI | InChI=1S/C26H35N3O3/c1-26(2,3)32-25(30)28-23(18-21-12-6-4-7-13-21)24(19-27-29-16-10-11-17-29)31-20-22-14-8-5-9-15-22/h4-9,12-15,19,23-24H,10-11,16-18,20H2,1-3H3,(H,28,30)/b27-19+/t23-,24+/m0/s1 |
| InChIKey | BUSNUXVVPBPGTJ-XPHXIRLRSA-N |
| XLogP | 4.79 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|