C15H24O3Si — CID 134875046
cis-methyl (1R,2S)-2-ethenyl-1-[(2E)-penta-2,4-dienyl]-2-trimethylsilyloxycyclopropane-1-carboxylate (PubChem CID 134875046) has the molecular formula C15H24O3Si and a molecular weight of 280.44 g/mol. Its IUPAC name is cis-methyl (1R,2S)-2-ethenyl-1-[(2E)-penta-2,4-dienyl]-2-trimethylsilyloxycyclopropane-1-carboxylate.
| Compound Name | cis-methyl (1R,2S)-2-ethenyl-1-[(2E)-penta-2,4-dienyl]-2-trimethylsilyloxycyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 134875046 |
| Molecular Formula | C15H24O3Si |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | cis-methyl (1R,2S)-2-ethenyl-1-[(2E)-penta-2,4-dienyl]-2-trimethylsilyloxycyclopropane-1-carboxylate |
| SMILES | C=C/C=C/C[C@@]1(C(=O)OC)C[C@@]1(C=C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H24O3Si/c1-7-9-10-11-14(13(16)17-3)12-15(14,8-2)18-19(4,5)6/h7-10H,1-2,11-12H2,3-6H3/b10-9+/t14-,15+/m0/s1 |
| InChIKey | OACNVDORDKYVOT-LWLVDVGCSA-N |
| XLogP | 3.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|