C22H35FO4 — CID 134875048
6-fluoro-2,2,6-trimethyl-5-(oxan-2-yloxy)-7-phenylmethoxyheptan-3-ol (PubChem CID 134875048) has the molecular formula C22H35FO4 and a molecular weight of 382.52 g/mol. Its IUPAC name is 6-fluoro-2,2,6-trimethyl-5-(oxan-2-yloxy)-7-phenylmethoxyheptan-3-ol.
| Compound Name | 6-fluoro-2,2,6-trimethyl-5-(oxan-2-yloxy)-7-phenylmethoxyheptan-3-ol |
|---|---|
| PubChem CID | 134875048 |
| Molecular Formula | C22H35FO4 |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 6-fluoro-2,2,6-trimethyl-5-(oxan-2-yloxy)-7-phenylmethoxyheptan-3-ol |
| SMILES | CC(C)(C)C(O)CC(OC1CCCCO1)C(C)(F)COCc1ccccc1 |
| InChI | InChI=1S/C22H35FO4/c1-21(2,3)18(24)14-19(27-20-12-8-9-13-26-20)22(4,23)16-25-15-17-10-6-5-7-11-17/h5-7,10-11,18-20,24H,8-9,12-16H2,1-4H3 |
| InChIKey | VAHXSYAITJCUJN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |