C9H10BrClO3 — CID 134875056
(3aR,4S,7aS)-4-bromo-7-chloro-2,2-dimethyl-4,7a-dihydro-3aH-1,3-benzodioxol-5-one (PubChem CID 134875056) has the molecular formula C9H10BrClO3 and a molecular weight of 281.53 g/mol. Its IUPAC name is (3aR,4S,7aS)-4-bromo-7-chloro-2,2-dimethyl-4,7a-dihydro-3aH-1,3-benzodioxol-5-one.
| Compound Name | (3aR,4S,7aS)-4-bromo-7-chloro-2,2-dimethyl-4,7a-dihydro-3aH-1,3-benzodioxol-5-one |
|---|---|
| PubChem CID | 134875056 |
| Molecular Formula | C9H10BrClO3 |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 279.95 |
| IUPAC Name | (3aR,4S,7aS)-4-bromo-7-chloro-2,2-dimethyl-4,7a-dihydro-3aH-1,3-benzodioxol-5-one |
| SMILES | CC1(C)O[C@H]2[C@H](Br)C(=O)C=C(Cl)[C@H]2O1 |
| InChI | InChI=1S/C9H10BrClO3/c1-9(2)13-7-4(11)3-5(12)6(10)8(7)14-9/h3,6-8H,1-2H3/t6-,7-,8+/m1/s1 |
| InChIKey | QSXOXBUFNUUGNA-PRJMDXOYSA-N |
| XLogP | 1.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|