About CID 134875126
CID 134875126 (PubChem CID 134875126) has the molecular formula C24H34FeN2O
and a molecular weight of 422.39 g/mol.
Molecular Properties
| Compound Name | CID 134875126 |
| PubChem CID | 134875126 |
| Molecular Formula | C24H34FeN2O |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | — |
| SMILES | COC[C@@H]1CCCN1/N=C(/[C]1[CH][CH][CH][C]1C)C1CCCCC1.[CH]1[CH][CH][CH][CH]1.[Fe] |
| InChI | InChI=1S/C19H29N2O.C5H5.Fe/c1-15-8-6-12-18(15)19(16-9-4-3-5-10-16)20-21-13-7-11-17(21)14-22-2;1-2-4-5-3-1;/h6,8,12,16-17H,3-5,7,9-11,13-14H2,1-2H3;1-5H;/b20-19+;;/t17-;;/m0../s1 |
| InChIKey | VTZRPPWVHZIIKA-UYZMSATPSA-N |
| XLogP | 4.85 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 134875126 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134875126?
The IUPAC name of CID 134875126 (CID 134875126) is not available.
What is the SMILES notation for CID 134875126?
The canonical SMILES for CID 134875126 is COC[C@@H]1CCCN1/N=C(/[C]1[CH][CH][CH][C]1C)C1CCCCC1.[CH]1[CH][CH][CH][CH]1.[Fe].
What is the InChIKey of CID 134875126?
The InChIKey is VTZRPPWVHZIIKA-UYZMSATPSA-N. The full InChI is InChI=1S/C19H29N2O.C5H5.Fe/c1-15-8-6-12-18(15)19(16-9-4-3-5-10-16)20-21-13-7-11-17(21)14-22-2;1-2-4-5-3-1;/h6,8,12,16-17H,3-5,7,9-11,13-14H2,1-2H3;1-5H;/b20-19+;;/t17-;;/m0../s1.
What are the key properties of CID 134875126?
CID 134875126 has a molecular weight of 422.39 g/mol, XLogP of 4.85, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134875126 is sourced from PubChem (CID 134875126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).