C15H28ClN3 — CID 134875136
[(Z)-2,3-di(piperidin-1-yl)prop-2-enylidene]-dimethylazanium chloride (PubChem CID 134875136) has the molecular formula C15H28ClN3 and a molecular weight of 285.86 g/mol. Its IUPAC name is [(Z)-2,3-di(piperidin-1-yl)prop-2-enylidene]-dimethylazanium chloride.
| Compound Name | [(Z)-2,3-di(piperidin-1-yl)prop-2-enylidene]-dimethylazanium chloride |
|---|---|
| PubChem CID | 134875136 |
| Molecular Formula | C15H28ClN3 |
| Molecular Weight | 285.86 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | [(Z)-2,3-di(piperidin-1-yl)prop-2-enylidene]-dimethylazanium chloride |
| SMILES | C[N+](C)=C/C(=C/N1CCCCC1)N1CCCCC1.[Cl-] |
| InChI | InChI=1S/C15H28N3.ClH/c1-16(2)13-15(18-11-7-4-8-12-18)14-17-9-5-3-6-10-17;/h13-14H,3-12H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | SVBOFFANBIXMSJ-UHFFFAOYSA-M |
| XLogP | -0.85 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.86 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|