C27H42O3S — CID 134875219
[(3R,8S,9S,10R,13R,14S,17R)-17-[(2R)-5-ethylsulfanyl-5-oxopentan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate (PubChem CID 134875219) has the molecular formula C27H42O3S and a molecular weight of 446.70 g/mol. Its IUPAC name is [(3R,8S,9S,10R,13R,14S,17R)-17-[(2R)-5-ethylsulfanyl-5-oxopentan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate.
| Compound Name | [(3R,8S,9S,10R,13R,14S,17R)-17-[(2R)-5-ethylsulfanyl-5-oxopentan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate |
|---|---|
| PubChem CID | 134875219 |
| Molecular Formula | C27H42O3S |
| Molecular Weight | 446.70 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | [(3R,8S,9S,10R,13R,14S,17R)-17-[(2R)-5-ethylsulfanyl-5-oxopentan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate |
| SMILES | CCSC(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](OC=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H42O3S/c1-5-31-25(29)11-6-18(2)22-9-10-23-21-8-7-19-16-20(30-17-28)12-14-26(19,3)24(21)13-15-27(22,23)4/h7,17-18,20-24H,5-6,8-16H2,1-4H3/t18-,20-,21+,22-,23+,24+,26+,27-/m1/s1 |
| InChIKey | FZYXSVBOGFSTTD-UDLBQRMISA-N |
| XLogP | 6.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.70 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|