C24H21NO2 — CID 134875263
(4S,5R)-2-(3,3-diphenyloxiran-2-yl)-4-methyl-5-phenyl-4,5-dihydro-1,3-oxazole (PubChem CID 134875263) has the molecular formula C24H21NO2 and a molecular weight of 355.44 g/mol. Its IUPAC name is (4S,5R)-2-(3,3-diphenyloxiran-2-yl)-4-methyl-5-phenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S,5R)-2-(3,3-diphenyloxiran-2-yl)-4-methyl-5-phenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 134875263 |
| Molecular Formula | C24H21NO2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (4S,5R)-2-(3,3-diphenyloxiran-2-yl)-4-methyl-5-phenyl-4,5-dihydro-1,3-oxazole |
| SMILES | C[C@@H]1N=C(C2OC2(c2ccccc2)c2ccccc2)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H21NO2/c1-17-21(18-11-5-2-6-12-18)26-23(25-17)22-24(27-22,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-17,21-22H,1H3/t17-,21-,22?/m0/s1 |
| InChIKey | LCNVTDXVWPCEOF-MNDAUZPPSA-N |
| XLogP | 4.89 |
| TPSA | 34.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|