C20H40O4Si — CID 134875286
(4E,6R,7S,8S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-6,8-dimethyldeca-1,4-dien-3-ol (PubChem CID 134875286) has the molecular formula C20H40O4Si and a molecular weight of 372.62 g/mol. Its IUPAC name is (4E,6R,7S,8S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-6,8-dimethyldeca-1,4-dien-3-ol.
| Compound Name | (4E,6R,7S,8S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-6,8-dimethyldeca-1,4-dien-3-ol |
|---|---|
| PubChem CID | 134875286 |
| Molecular Formula | C20H40O4Si |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (4E,6R,7S,8S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-6,8-dimethyldeca-1,4-dien-3-ol |
| SMILES | C=CC(O)/C=C/[C@@H](C)[C@H](OCOC)[C@H](C)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O4Si/c1-11-18(21)13-12-15(2)19(23-14-22-8)16(3)17(4)24-25(9,10)20(5,6)7/h11-13,15-19,21H,1,14H2,2-10H3/b13-12+/t15-,16-,17-,18?,19+/m1/s1 |
| InChIKey | NWDOYLQFPMXNHC-WPUXVHILSA-N |
| XLogP | 4.76 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|