C14H24O2 — CID 134875292
(1S,2S,5S)-2-butyl-1-methoxy-5-methylbicyclo[3.2.1]oct-3-en-2-ol (PubChem CID 134875292) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (1S,2S,5S)-2-butyl-1-methoxy-5-methylbicyclo[3.2.1]oct-3-en-2-ol.
| Compound Name | (1S,2S,5S)-2-butyl-1-methoxy-5-methylbicyclo[3.2.1]oct-3-en-2-ol |
|---|---|
| PubChem CID | 134875292 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (1S,2S,5S)-2-butyl-1-methoxy-5-methylbicyclo[3.2.1]oct-3-en-2-ol |
| SMILES | CCCC[C@]1(O)C=C[C@@]2(C)CC[C@]1(OC)C2 |
| InChI | InChI=1S/C14H24O2/c1-4-5-6-13(15)9-7-12(2)8-10-14(13,11-12)16-3/h7,9,15H,4-6,8,10-11H2,1-3H3/t12-,13-,14-/m0/s1 |
| InChIKey | OEKSGXUITDCKHK-IHRRRGAJSA-N |
| XLogP | 3.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|