C12H20O2 — CID 134875419
(1S,2S,5S)-1-methoxy-2,4,5-trimethylbicyclo[3.2.1]oct-3-en-2-ol (PubChem CID 134875419) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (1S,2S,5S)-1-methoxy-2,4,5-trimethylbicyclo[3.2.1]oct-3-en-2-ol.
| Compound Name | (1S,2S,5S)-1-methoxy-2,4,5-trimethylbicyclo[3.2.1]oct-3-en-2-ol |
|---|---|
| PubChem CID | 134875419 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (1S,2S,5S)-1-methoxy-2,4,5-trimethylbicyclo[3.2.1]oct-3-en-2-ol |
| SMILES | CO[C@@]12CC[C@@](C)(C1)C(C)=C[C@]2(C)O |
| InChI | InChI=1S/C12H20O2/c1-9-7-11(3,13)12(14-4)6-5-10(9,2)8-12/h7,13H,5-6,8H2,1-4H3/t10-,11-,12-/m0/s1 |
| InChIKey | PXVJPTFTUYHXAQ-SRVKXCTJSA-N |
| XLogP | 2.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|