C15H26O2 — CID 134875484
(1S,2R,5S)-2-tert-butyl-1-methoxy-4,5-dimethylbicyclo[3.2.1]oct-3-en-2-ol (PubChem CID 134875484) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (1S,2R,5S)-2-tert-butyl-1-methoxy-4,5-dimethylbicyclo[3.2.1]oct-3-en-2-ol.
| Compound Name | (1S,2R,5S)-2-tert-butyl-1-methoxy-4,5-dimethylbicyclo[3.2.1]oct-3-en-2-ol |
|---|---|
| PubChem CID | 134875484 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (1S,2R,5S)-2-tert-butyl-1-methoxy-4,5-dimethylbicyclo[3.2.1]oct-3-en-2-ol |
| SMILES | CO[C@@]12CC[C@@](C)(C1)C(C)=C[C@@]2(O)C(C)(C)C |
| InChI | InChI=1S/C15H26O2/c1-11-9-15(16,12(2,3)4)14(17-6)8-7-13(11,5)10-14/h9,16H,7-8,10H2,1-6H3/t13-,14-,15+/m0/s1 |
| InChIKey | LUNZCZCUUFFLNP-SOUVJXGZSA-N |
| XLogP | 3.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|