C25H34O4S — CID 134875496
S-ethyl (1R,2R,4aS,8aR)-2-[4-[(4-methoxyphenyl)methoxy]butyl]-6-oxo-2,4a,5,7,8,8a-hexahydro-1H-naphthalene-1-carbothioate (PubChem CID 134875496) has the molecular formula C25H34O4S and a molecular weight of 430.61 g/mol. Its IUPAC name is S-ethyl (1R,2R,4aS,8aR)-2-[4-[(4-methoxyphenyl)methoxy]butyl]-6-oxo-2,4a,5,7,8,8a-hexahydro-1H-naphthalene-1-carbothioate.
| Compound Name | S-ethyl (1R,2R,4aS,8aR)-2-[4-[(4-methoxyphenyl)methoxy]butyl]-6-oxo-2,4a,5,7,8,8a-hexahydro-1H-naphthalene-1-carbothioate |
|---|---|
| PubChem CID | 134875496 |
| Molecular Formula | C25H34O4S |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | S-ethyl (1R,2R,4aS,8aR)-2-[4-[(4-methoxyphenyl)methoxy]butyl]-6-oxo-2,4a,5,7,8,8a-hexahydro-1H-naphthalene-1-carbothioate |
| SMILES | CCSC(=O)[C@H]1[C@@H]2CCC(=O)C[C@H]2C=C[C@H]1CCCCOCc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H34O4S/c1-3-30-25(27)24-19(9-10-20-16-21(26)11-14-23(20)24)6-4-5-15-29-17-18-7-12-22(28-2)13-8-18/h7-10,12-13,19-20,23-24H,3-6,11,14-17H2,1-2H3/t19-,20-,23-,24-/m1/s1 |
| InChIKey | ZVFARIOPKCOQOS-FAYOUJPWSA-N |
| XLogP | 5.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|