C16H26O3 — CID 134875515
(3aR,6S,6aR)-1,5,5-trimethyl-6-(oxan-2-yloxy)-1,3,3a,4,6,6a-hexahydropentalen-2-one (PubChem CID 134875515) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is (3aR,6S,6aR)-1,5,5-trimethyl-6-(oxan-2-yloxy)-1,3,3a,4,6,6a-hexahydropentalen-2-one.
| Compound Name | (3aR,6S,6aR)-1,5,5-trimethyl-6-(oxan-2-yloxy)-1,3,3a,4,6,6a-hexahydropentalen-2-one |
|---|---|
| PubChem CID | 134875515 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (3aR,6S,6aR)-1,5,5-trimethyl-6-(oxan-2-yloxy)-1,3,3a,4,6,6a-hexahydropentalen-2-one |
| SMILES | CC1C(=O)C[C@H]2CC(C)(C)[C@@H](OC3CCCCO3)[C@@H]12 |
| InChI | InChI=1S/C16H26O3/c1-10-12(17)8-11-9-16(2,3)15(14(10)11)19-13-6-4-5-7-18-13/h10-11,13-15H,4-9H2,1-3H3/t10?,11-,13?,14-,15-/m0/s1 |
| InChIKey | LLVXBPJZZWTFRC-WGZTXMMSSA-N |
| XLogP | 3.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |