C17H24O6 — CID 134875609
methyl (2E)-2-[(2R,3S)-2-[(E)-2-acetyloxyethenyl]-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclopentylidene]acetate (PubChem CID 134875609) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is methyl (2E)-2-[(2R,3S)-2-[(E)-2-acetyloxyethenyl]-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclopentylidene]acetate.
| Compound Name | methyl (2E)-2-[(2R,3S)-2-[(E)-2-acetyloxyethenyl]-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclopentylidene]acetate |
|---|---|
| PubChem CID | 134875609 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | methyl (2E)-2-[(2R,3S)-2-[(E)-2-acetyloxyethenyl]-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclopentylidene]acetate |
| SMILES | COC(=O)/C=C1\CC[C@H]([C@@H]2COC(C)(C)O2)[C@H]1/C=C/OC(C)=O |
| InChI | InChI=1S/C17H24O6/c1-11(18)21-8-7-13-12(9-16(19)20-4)5-6-14(13)15-10-22-17(2,3)23-15/h7-9,13-15H,5-6,10H2,1-4H3/b8-7+,12-9+/t13-,14-,15-/m0/s1 |
| InChIKey | REGDXXQMUSJWQW-MYQPWPKSSA-N |
| XLogP | 2.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|