C28H48N6O6 — CID 134875668
4-(1,1,4,4,4-pentamorpholin-4-ylbut-2-ynyl)morpholine (PubChem CID 134875668) has the molecular formula C28H48N6O6 and a molecular weight of 564.73 g/mol. Its IUPAC name is 4-(1,1,4,4,4-pentamorpholin-4-ylbut-2-ynyl)morpholine.
| Compound Name | 4-(1,1,4,4,4-pentamorpholin-4-ylbut-2-ynyl)morpholine |
|---|---|
| PubChem CID | 134875668 |
| Molecular Formula | C28H48N6O6 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.36 |
| IUPAC Name | 4-(1,1,4,4,4-pentamorpholin-4-ylbut-2-ynyl)morpholine |
| SMILES | C(#CC(N1CCOCC1)(N1CCOCC1)N1CCOCC1)C(N1CCOCC1)(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C28H48N6O6/c1(27(29-3-15-35-16-4-29,30-5-17-36-18-6-30)31-7-19-37-20-8-31)2-28(32-9-21-38-22-10-32,33-11-23-39-24-12-33)34-13-25-40-26-14-34/h3-26H2 |
| InChIKey | FMTFDQFYWXVMNC-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 74.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|