C21H26O6 — CID 134875673
methyl (2R,3S,4S,8S,9R,11S,12R)-8,12-dihydroxy-11-methyl-17-methylidene-16-oxo-15-oxapentacyclo[9.3.2.24,8.01,10.03,9]octadec-13-ene-2-carboxylate (PubChem CID 134875673) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is methyl (2R,3S,4S,8S,9R,11S,12R)-8,12-dihydroxy-11-methyl-17-methylidene-16-oxo-15-oxapentacyclo[9.3.2.24,8.01,10.03,9]octadec-13-ene-2-carboxylate.
| Compound Name | methyl (2R,3S,4S,8S,9R,11S,12R)-8,12-dihydroxy-11-methyl-17-methylidene-16-oxo-15-oxapentacyclo[9.3.2.24,8.01,10.03,9]octadec-13-ene-2-carboxylate |
|---|---|
| PubChem CID | 134875673 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | methyl (2R,3S,4S,8S,9R,11S,12R)-8,12-dihydroxy-11-methyl-17-methylidene-16-oxo-15-oxapentacyclo[9.3.2.24,8.01,10.03,9]octadec-13-ene-2-carboxylate |
| SMILES | C=C1C[C@@H]2CCC[C@]1(O)C1C3C4(C=C[C@@H](O)[C@@]3(C)C(=O)O4)[C@H](C(=O)OC)[C@H]12 |
| InChI | InChI=1S/C21H26O6/c1-10-9-11-5-4-7-20(10,25)14-13(11)15(17(23)26-3)21-8-6-12(22)19(2,16(14)21)18(24)27-21/h6,8,11-16,22,25H,1,4-5,7,9H2,2-3H3/t11-,12+,13-,14?,15-,16?,19+,20+,21?/m0/s1 |
| InChIKey | MQYLGUOOXWCXHE-FZWNGUJGSA-N |
| XLogP | 1.36 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|