C29H31F3O8S — CID 134875695
[(2S,3R,4S,5R,6R)-2-methoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] trifluoromethanesulfonate (PubChem CID 134875695) has the molecular formula C29H31F3O8S and a molecular weight of 596.62 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-2-methoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] trifluoromethanesulfonate.
| Compound Name | [(2S,3R,4S,5R,6R)-2-methoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134875695 |
| Molecular Formula | C29H31F3O8S |
| Molecular Weight | 596.62 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-2-methoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] trifluoromethanesulfonate |
| SMILES | CO[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C29H31F3O8S/c1-35-28-27(40-41(33,34)29(30,31)32)26(38-19-23-15-9-4-10-16-23)25(37-18-22-13-7-3-8-14-22)24(39-28)20-36-17-21-11-5-2-6-12-21/h2-16,24-28H,17-20H2,1H3/t24-,25-,26+,27-,28+/m1/s1 |
| InChIKey | MKFMYAVNRXXNIF-DFLSAPQXSA-N |
| XLogP | 4.98 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|