About 2-(benzenesulfonyl)-1-(2,4-dimethoxyphenyl)-2-fluoroethanol
2-(benzenesulfonyl)-1-(2,4-dimethoxyphenyl)-2-fluoroethanol (PubChem CID 134876154) has the molecular formula C16H17FO5S
and a molecular weight of 340.37 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-(2,4-dimethoxyphenyl)-2-fluoroethanol.
Molecular Properties
| Compound Name | 2-(benzenesulfonyl)-1-(2,4-dimethoxyphenyl)-2-fluoroethanol |
| PubChem CID | 134876154 |
| Molecular Formula | C16H17FO5S |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 2-(benzenesulfonyl)-1-(2,4-dimethoxyphenyl)-2-fluoroethanol |
| SMILES | COc1ccc(C(O)C(F)S(=O)(=O)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C16H17FO5S/c1-21-11-8-9-13(14(10-11)22-2)15(18)16(17)23(19,20)12-6-4-3-5-7-12/h3-10,15-16,18H,1-2H3 |
| InChIKey | ZPYQUPPMELPJHT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(benzenesulfonyl)-1-(2,4-dimethoxyphenyl)-2-fluoroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyl)-1-(2,4-dimethoxyphenyl)-2-fluoroethanol?
The IUPAC name of 2-(benzenesulfonyl)-1-(2,4-dimethoxyphenyl)-2-fluoroethanol (CID 134876154) is 2-(benzenesulfonyl)-1-(2,4-dimethoxyphenyl)-2-fluoroethanol.
What is the SMILES notation for 2-(benzenesulfonyl)-1-(2,4-dimethoxyphenyl)-2-fluoroethanol?
The canonical SMILES for 2-(benzenesulfonyl)-1-(2,4-dimethoxyphenyl)-2-fluoroethanol is COc1ccc(C(O)C(F)S(=O)(=O)c2ccccc2)c(OC)c1.
What is the InChIKey of 2-(benzenesulfonyl)-1-(2,4-dimethoxyphenyl)-2-fluoroethanol?
The InChIKey is ZPYQUPPMELPJHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FO5S/c1-21-11-8-9-13(14(10-11)22-2)15(18)16(17)23(19,20)12-6-4-3-5-7-12/h3-10,15-16,18H,1-2H3.
What are the key properties of 2-(benzenesulfonyl)-1-(2,4-dimethoxyphenyl)-2-fluoroethanol?
2-(benzenesulfonyl)-1-(2,4-dimethoxyphenyl)-2-fluoroethanol has a molecular weight of 340.37 g/mol, XLogP of 2.51, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyl)-1-(2,4-dimethoxyphenyl)-2-fluoroethanol is sourced from PubChem (CID 134876154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).