C11H9ClO4 — CID 134876186
(4aR,8aS)-6-chloro-4a,5,8,8a-tetrahydrobenzo[f][1,3]benzodioxole-4,9-dione (PubChem CID 134876186) has the molecular formula C11H9ClO4 and a molecular weight of 240.64 g/mol. Its IUPAC name is (4aR,8aS)-6-chloro-4a,5,8,8a-tetrahydrobenzo[f][1,3]benzodioxole-4,9-dione.
| Compound Name | (4aR,8aS)-6-chloro-4a,5,8,8a-tetrahydrobenzo[f][1,3]benzodioxole-4,9-dione |
|---|---|
| PubChem CID | 134876186 |
| Molecular Formula | C11H9ClO4 |
| Molecular Weight | 240.64 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | (4aR,8aS)-6-chloro-4a,5,8,8a-tetrahydrobenzo[f][1,3]benzodioxole-4,9-dione |
| SMILES | O=C1C2=C(OCO2)C(=O)[C@@H]2CC(Cl)=CC[C@H]12 |
| InChI | InChI=1S/C11H9ClO4/c12-5-1-2-6-7(3-5)9(14)11-10(8(6)13)15-4-16-11/h1,6-7H,2-4H2/t6-,7+/m0/s1 |
| InChIKey | MHBHQBQPCAVQOB-NKWVEPMBSA-N |
| XLogP | 1.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.64 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |