About (Z)-N-[(E)-1-phenylethylideneamino]-1-(triphenyl-λ5-phosphanylidene)propan-2-imine
(Z)-N-[(E)-1-phenylethylideneamino]-1-(triphenyl-λ5-phosphanylidene)propan-2-imine (PubChem CID 134877191) has the molecular formula C29H27N2P
and a molecular weight of 434.52 g/mol. Its IUPAC name is (Z)-N-[(E)-1-phenylethylideneamino]-1-(triphenyl-λ5-phosphanylidene)propan-2-imine.
Molecular Properties
| Compound Name | (Z)-N-[(E)-1-phenylethylideneamino]-1-(triphenyl-λ5-phosphanylidene)propan-2-imine |
| PubChem CID | 134877191 |
| Molecular Formula | C29H27N2P |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | (Z)-N-[(E)-1-phenylethylideneamino]-1-(triphenyl-λ5-phosphanylidene)propan-2-imine |
| SMILES | C/C(C=P(c1ccccc1)(c1ccccc1)c1ccccc1)=N/N=C(\C)c1ccccc1 |
| InChI | InChI=1S/C29H27N2P/c1-24(30-31-25(2)26-15-7-3-8-16-26)23-32(27-17-9-4-10-18-27,28-19-11-5-12-20-28)29-21-13-6-14-22-29/h3-23H,1-2H3/b30-24-,31-25+ |
| InChIKey | ZTLZEIIUTQPHHF-LQAAPGBJSA-N |
| XLogP | 5.67 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-[(E)-1-phenylethylideneamino]-1-(triphenyl-λ5-phosphanylidene)propan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-[(E)-1-phenylethylideneamino]-1-(triphenyl-λ5-phosphanylidene)propan-2-imine?
The IUPAC name of (Z)-N-[(E)-1-phenylethylideneamino]-1-(triphenyl-λ5-phosphanylidene)propan-2-imine (CID 134877191) is (Z)-N-[(E)-1-phenylethylideneamino]-1-(triphenyl-λ5-phosphanylidene)propan-2-imine.
What is the SMILES notation for (Z)-N-[(E)-1-phenylethylideneamino]-1-(triphenyl-λ5-phosphanylidene)propan-2-imine?
The canonical SMILES for (Z)-N-[(E)-1-phenylethylideneamino]-1-(triphenyl-λ5-phosphanylidene)propan-2-imine is C/C(C=P(c1ccccc1)(c1ccccc1)c1ccccc1)=N/N=C(\C)c1ccccc1.
What is the InChIKey of (Z)-N-[(E)-1-phenylethylideneamino]-1-(triphenyl-λ5-phosphanylidene)propan-2-imine?
The InChIKey is ZTLZEIIUTQPHHF-LQAAPGBJSA-N. The full InChI is InChI=1S/C29H27N2P/c1-24(30-31-25(2)26-15-7-3-8-16-26)23-32(27-17-9-4-10-18-27,28-19-11-5-12-20-28)29-21-13-6-14-22-29/h3-23H,1-2H3/b30-24-,31-25+.
What are the key properties of (Z)-N-[(E)-1-phenylethylideneamino]-1-(triphenyl-λ5-phosphanylidene)propan-2-imine?
(Z)-N-[(E)-1-phenylethylideneamino]-1-(triphenyl-λ5-phosphanylidene)propan-2-imine has a molecular weight of 434.52 g/mol, XLogP of 5.67, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-[(E)-1-phenylethylideneamino]-1-(triphenyl-λ5-phosphanylidene)propan-2-imine is sourced from PubChem (CID 134877191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).