About diethyl 2-[(E)-4-(dimethyl-λ4-sulfanylidene)but-2-enyl]-2-phenylsulfanylpropanedioate
diethyl 2-[(E)-4-(dimethyl-λ4-sulfanylidene)but-2-enyl]-2-phenylsulfanylpropanedioate (PubChem CID 134877206) has the molecular formula C19H26O4S2
and a molecular weight of 382.55 g/mol. Its IUPAC name is diethyl 2-[(E)-4-(dimethyl-λ4-sulfanylidene)but-2-enyl]-2-phenylsulfanylpropanedioate.
Molecular Properties
| Compound Name | diethyl 2-[(E)-4-(dimethyl-λ4-sulfanylidene)but-2-enyl]-2-phenylsulfanylpropanedioate |
| PubChem CID | 134877206 |
| Molecular Formula | C19H26O4S2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | diethyl 2-[(E)-4-(dimethyl-λ4-sulfanylidene)but-2-enyl]-2-phenylsulfanylpropanedioate |
| SMILES | CCOC(=O)C(C/C=C/C=S(C)C)(Sc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C19H26O4S2/c1-5-22-17(20)19(18(21)23-6-2,14-10-11-15-25(3)4)24-16-12-8-7-9-13-16/h7-13,15H,5-6,14H2,1-4H3/b11-10+ |
| InChIKey | SYVFJMOUAJBRBJ-ZHACJKMWSA-N |
| XLogP | 3.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[(E)-4-(dimethyl-λ4-sulfanylidene)but-2-enyl]-2-phenylsulfanylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[(E)-4-(dimethyl-λ4-sulfanylidene)but-2-enyl]-2-phenylsulfanylpropanedioate?
The IUPAC name of diethyl 2-[(E)-4-(dimethyl-λ4-sulfanylidene)but-2-enyl]-2-phenylsulfanylpropanedioate (CID 134877206) is diethyl 2-[(E)-4-(dimethyl-λ4-sulfanylidene)but-2-enyl]-2-phenylsulfanylpropanedioate.
What is the SMILES notation for diethyl 2-[(E)-4-(dimethyl-λ4-sulfanylidene)but-2-enyl]-2-phenylsulfanylpropanedioate?
The canonical SMILES for diethyl 2-[(E)-4-(dimethyl-λ4-sulfanylidene)but-2-enyl]-2-phenylsulfanylpropanedioate is CCOC(=O)C(C/C=C/C=S(C)C)(Sc1ccccc1)C(=O)OCC.
What is the InChIKey of diethyl 2-[(E)-4-(dimethyl-λ4-sulfanylidene)but-2-enyl]-2-phenylsulfanylpropanedioate?
The InChIKey is SYVFJMOUAJBRBJ-ZHACJKMWSA-N. The full InChI is InChI=1S/C19H26O4S2/c1-5-22-17(20)19(18(21)23-6-2,14-10-11-15-25(3)4)24-16-12-8-7-9-13-16/h7-13,15H,5-6,14H2,1-4H3/b11-10+.
What are the key properties of diethyl 2-[(E)-4-(dimethyl-λ4-sulfanylidene)but-2-enyl]-2-phenylsulfanylpropanedioate?
diethyl 2-[(E)-4-(dimethyl-λ4-sulfanylidene)but-2-enyl]-2-phenylsulfanylpropanedioate has a molecular weight of 382.55 g/mol, XLogP of 3.92, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[(E)-4-(dimethyl-λ4-sulfanylidene)but-2-enyl]-2-phenylsulfanylpropanedioate is sourced from PubChem (CID 134877206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).