C12H17N2S+ — CID 134877300
dimethyl-[(2,3,6-trimethylpyrrolo[2,1-b][1,3]thiazol-5-yl)methylidene]azanium (PubChem CID 134877300) has the molecular formula C12H17N2S+ and a molecular weight of 221.35 g/mol. Its IUPAC name is dimethyl-[(2,3,6-trimethylpyrrolo[2,1-b][1,3]thiazol-5-yl)methylidene]azanium.
| Compound Name | dimethyl-[(2,3,6-trimethylpyrrolo[2,1-b][1,3]thiazol-5-yl)methylidene]azanium |
|---|---|
| PubChem CID | 134877300 |
| Molecular Formula | C12H17N2S+ |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | dimethyl-[(2,3,6-trimethylpyrrolo[2,1-b][1,3]thiazol-5-yl)methylidene]azanium |
| SMILES | Cc1cc2sc(C)c(C)n2c1C=[N+](C)C |
| InChI | InChI=1S/C12H17N2S/c1-8-6-12-14(9(2)10(3)15-12)11(8)7-13(4)5/h6-7H,1-5H3/q+1 |
| InChIKey | KXEIUOOFAXYDCR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 7.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|