About methylsulfonyl (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate
methylsulfonyl (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 134877320) has the molecular formula C11H11F3O5S
and a molecular weight of 312.27 g/mol. Its IUPAC name is methylsulfonyl (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
Molecular Properties
| Compound Name | methylsulfonyl (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| PubChem CID | 134877320 |
| Molecular Formula | C11H11F3O5S |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | methylsulfonyl (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@](C(=O)OS(C)(=O)=O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H11F3O5S/c1-18-10(11(12,13)14,8-6-4-3-5-7-8)9(15)19-20(2,16)17/h3-7H,1-2H3/t10-/m0/s1 |
| InChIKey | OXGBNYAIVJTQPQ-JTQLQIEISA-N |
| XLogP | 1.59 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methylsulfonyl (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfonyl (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate?
The IUPAC name of methylsulfonyl (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (CID 134877320) is methylsulfonyl (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
What is the SMILES notation for methylsulfonyl (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate?
The canonical SMILES for methylsulfonyl (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate is CO[C@](C(=O)OS(C)(=O)=O)(c1ccccc1)C(F)(F)F.
What is the InChIKey of methylsulfonyl (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate?
The InChIKey is OXGBNYAIVJTQPQ-JTQLQIEISA-N. The full InChI is InChI=1S/C11H11F3O5S/c1-18-10(11(12,13)14,8-6-4-3-5-7-8)9(15)19-20(2,16)17/h3-7H,1-2H3/t10-/m0/s1.
What are the key properties of methylsulfonyl (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate?
methylsulfonyl (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate has a molecular weight of 312.27 g/mol, XLogP of 1.59, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfonyl (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate is sourced from PubChem (CID 134877320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).