C16H23NO6 — CID 134877367
(2R,4aR,6S,7S,8S,8aS)-8-hydroxy-6-methoxy-N,N-dimethyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine oxide (PubChem CID 134877367) has the molecular formula C16H23NO6 and a molecular weight of 325.36 g/mol. Its IUPAC name is (2R,4aR,6S,7S,8S,8aS)-8-hydroxy-6-methoxy-N,N-dimethyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine oxide.
| Compound Name | (2R,4aR,6S,7S,8S,8aS)-8-hydroxy-6-methoxy-N,N-dimethyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine oxide |
|---|---|
| PubChem CID | 134877367 |
| Molecular Formula | C16H23NO6 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (2R,4aR,6S,7S,8S,8aS)-8-hydroxy-6-methoxy-N,N-dimethyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine oxide |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@@H](O)[C@@H]1[N+](C)(C)[O-] |
| InChI | InChI=1S/C16H23NO6/c1-17(2,19)12-13(18)14-11(22-16(12)20-3)9-21-15(23-14)10-7-5-4-6-8-10/h4-8,11-16,18H,9H2,1-3H3/t11-,12+,13+,14-,15-,16+/m1/s1 |
| InChIKey | OVTYWNJIKHSPRA-JOWFITRBSA-N |
| XLogP | 0.78 |
| TPSA | 80.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|