C21H32O3S — CID 134877481
1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-3-phenylmethoxypropan-1-ol (PubChem CID 134877481) has the molecular formula C21H32O3S and a molecular weight of 364.55 g/mol. Its IUPAC name is 1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-3-phenylmethoxypropan-1-ol.
| Compound Name | 1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-3-phenylmethoxypropan-1-ol |
|---|---|
| PubChem CID | 134877481 |
| Molecular Formula | C21H32O3S |
| Molecular Weight | 364.55 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-3-phenylmethoxypropan-1-ol |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H](C(O)CCOCc1ccccc1)SC2(C)C |
| InChI | InChI=1S/C21H32O3S/c1-15-9-10-17-19(13-15)24-20(25-21(17,2)3)18(22)11-12-23-14-16-7-5-4-6-8-16/h4-8,15,17-20,22H,9-14H2,1-3H3/t15-,17-,18?,19-,20-/m1/s1 |
| InChIKey | BFVBYEUGCSPCGK-WGKPBGQSSA-N |
| XLogP | 4.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|