C29H39NO7Si — CID 134877562
[2-[(3aR,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2-oxazolidin-5-yl] acetate (PubChem CID 134877562) has the molecular formula C29H39NO7Si and a molecular weight of 541.72 g/mol. Its IUPAC name is [2-[(3aR,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2-oxazolidin-5-yl] acetate.
| Compound Name | [2-[(3aR,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2-oxazolidin-5-yl] acetate |
|---|---|
| PubChem CID | 134877562 |
| Molecular Formula | C29H39NO7Si |
| Molecular Weight | 541.72 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | [2-[(3aR,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2-oxazolidin-5-yl] acetate |
| SMILES | CC(=O)OC1CCN([C@H]2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H]3OC(C)(C)O[C@H]32)O1 |
| InChI | InChI=1S/C29H39NO7Si/c1-20(31)33-24-17-18-30(37-24)27-26-25(35-29(5,6)36-26)23(34-27)19-32-38(28(2,3)4,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,23-27H,17-19H2,1-6H3/t23-,24?,25-,26-,27+/m1/s1 |
| InChIKey | KUPMVOBWKZSJAV-ZKUZIBQXSA-N |
| XLogP | 3.33 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.72 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|