C20H30O3S — CID 134877597
1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-2-phenylmethoxyethanol (PubChem CID 134877597) has the molecular formula C20H30O3S and a molecular weight of 350.52 g/mol. Its IUPAC name is 1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-2-phenylmethoxyethanol.
| Compound Name | 1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-2-phenylmethoxyethanol |
|---|---|
| PubChem CID | 134877597 |
| Molecular Formula | C20H30O3S |
| Molecular Weight | 350.52 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-2-phenylmethoxyethanol |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H](C(O)COCc1ccccc1)SC2(C)C |
| InChI | InChI=1S/C20H30O3S/c1-14-9-10-16-18(11-14)23-19(24-20(16,2)3)17(21)13-22-12-15-7-5-4-6-8-15/h4-8,14,16-19,21H,9-13H2,1-3H3/t14-,16-,17?,18-,19-/m1/s1 |
| InChIKey | FLWITMMSMQWMIN-JOQSQSAMSA-N |
| XLogP | 4.24 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |