C14H12CrO8 — CID 134877687
[[(3aS,6aR)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-5-yl]-ethoxymethylidene]chromium;carbon monoxide (PubChem CID 134877687) has the molecular formula C14H12CrO8 and a molecular weight of 360.24 g/mol. Its IUPAC name is [[(3aS,6aR)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-5-yl]-ethoxymethylidene]chromium;carbon monoxide.
| Compound Name | [[(3aS,6aR)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-5-yl]-ethoxymethylidene]chromium;carbon monoxide |
|---|---|
| PubChem CID | 134877687 |
| Molecular Formula | C14H12CrO8 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | [[(3aS,6aR)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-5-yl]-ethoxymethylidene]chromium;carbon monoxide |
| SMILES | CCOC(=[Cr])C1=C[C@@H]2CCO[C@@H]2O1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C9H12O3.5CO.Cr/c1-2-10-6-8-5-7-3-4-11-9(7)12-8;5*1-2;/h5,7,9H,2-4H2,1H3;;;;;;/t7-,9+;;;;;;/m0....../s1 |
| InChIKey | CKFIVKHVJDNOFW-CAHSXCLXSA-N |
| XLogP | 0.79 |
| TPSA | 127.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|